C22H39N5O3S — CID 169139426
(Z)-1-[amino(ethyl)amino]-3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)prop-1-en-2-amine;N-(ethoxymethyl)formamide (PubChem CID 169139426) has the molecular formula C22H39N5O3S and a molecular weight of 453.65 g/mol. Its IUPAC name is (Z)-1-[amino(ethyl)amino]-3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)prop-1-en-2-amine;N-(ethoxymethyl)formamide.
| Compound Name | (Z)-1-[amino(ethyl)amino]-3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)prop-1-en-2-amine;N-(ethoxymethyl)formamide |
|---|---|
| PubChem CID | 169139426 |
| Molecular Formula | C22H39N5O3S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | (Z)-1-[amino(ethyl)amino]-3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)prop-1-en-2-amine;N-(ethoxymethyl)formamide |
| SMILES | CCOCNC=O.CCc1cc2c(s1)CCOC21CCN(C/C(N)=C/N(N)CC)CC1 |
| InChI | InChI=1S/C18H30N4OS.C4H9NO2/c1-3-15-11-16-17(24-15)5-10-23-18(16)6-8-21(9-7-18)12-14(19)13-22(20)4-2;1-2-7-4-5-3-6/h11,13H,3-10,12,19-20H2,1-2H3;3H,2,4H2,1H3,(H,5,6)/b14-13-; |
| InChIKey | RUFWHEGLMCMSJE-HPWRNOGASA-N |
| XLogP | 1.90 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|