C21H34N4OS — CID 174102923
3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)-2-hydrazinylidene-N-pentan-3-ylpropan-1-imine (PubChem CID 174102923) has the molecular formula C21H34N4OS and a molecular weight of 390.60 g/mol. Its IUPAC name is 3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)-2-hydrazinylidene-N-pentan-3-ylpropan-1-imine.
| Compound Name | 3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)-2-hydrazinylidene-N-pentan-3-ylpropan-1-imine |
|---|---|
| PubChem CID | 174102923 |
| Molecular Formula | C21H34N4OS |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 3-(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)-2-hydrazinylidene-N-pentan-3-ylpropan-1-imine |
| SMILES | CCc1cc2c(s1)CCOC21CCN(CC(/C=N/C(CC)CC)=NN)CC1 |
| InChI | InChI=1S/C21H34N4OS/c1-4-16(5-2)23-14-17(24-22)15-25-10-8-21(9-11-25)19-13-18(6-3)27-20(19)7-12-26-21/h13-14,16H,4-12,15,22H2,1-3H3/b23-14+,24-17? |
| InChIKey | IWWOHPIVWAPVNK-GWTAGLHBSA-N |
| XLogP | 3.75 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|