C21H34N4O3S — CID 176762403
1-[[(2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidenepropylidene]amino]-3-methoxypropan-2-ol (PubChem CID 176762403) has the molecular formula C21H34N4O3S and a molecular weight of 422.60 g/mol. Its IUPAC name is 1-[[(2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidenepropylidene]amino]-3-methoxypropan-2-ol.
| Compound Name | 1-[[(2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidenepropylidene]amino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 176762403 |
| Molecular Formula | C21H34N4O3S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-[[(2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidenepropylidene]amino]-3-methoxypropan-2-ol |
| SMILES | CCc1cc2c(s1)CCO[C@@]21CCN(CC(/C=N/CC(O)COC)=N/N)[C@@H](C)C1 |
| InChI | InChI=1S/C21H34N4O3S/c1-4-18-9-19-20(29-18)5-8-28-21(19)6-7-25(15(2)10-21)13-16(24-22)11-23-12-17(26)14-27-3/h9,11,15,17,26H,4-8,10,12-14,22H2,1-3H3/b23-11+,24-16+/t15-,17?,21+/m0/s1 |
| InChIKey | YIYUJXNTANMZPZ-ZXYCBEBLSA-N |
| XLogP | 1.96 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|