C26H42N4O2S — CID 176762328
(2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidene-N-[2-methyl-2-(oxan-4-yl)propyl]propan-1-imine (PubChem CID 176762328) has the molecular formula C26H42N4O2S and a molecular weight of 474.72 g/mol. Its IUPAC name is (2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidene-N-[2-methyl-2-(oxan-4-yl)propyl]propan-1-imine.
| Compound Name | (2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidene-N-[2-methyl-2-(oxan-4-yl)propyl]propan-1-imine |
|---|---|
| PubChem CID | 176762328 |
| Molecular Formula | C26H42N4O2S |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidene-N-[2-methyl-2-(oxan-4-yl)propyl]propan-1-imine |
| SMILES | CCc1cc2c(s1)CCO[C@@]21CCN(CC(/C=N/CC(C)(C)C2CCOCC2)=N/N)[C@@H](C)C1 |
| InChI | InChI=1S/C26H42N4O2S/c1-5-22-14-23-24(33-22)8-13-32-26(23)9-10-30(19(2)15-26)17-21(29-27)16-28-18-25(3,4)20-6-11-31-12-7-20/h14,16,19-20H,5-13,15,17-18,27H2,1-4H3/b28-16+,29-21+/t19-,26+/m0/s1 |
| InChIKey | JUVFHOJSUGLAPG-QHHXLNMASA-N |
| XLogP | 4.40 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|