C23H36N4O3S — CID 176762343
(2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidene-N-[(2-methyl-1,4-dioxan-2-yl)methyl]propan-1-imine (PubChem CID 176762343) has the molecular formula C23H36N4O3S and a molecular weight of 448.63 g/mol. Its IUPAC name is (2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidene-N-[(2-methyl-1,4-dioxan-2-yl)methyl]propan-1-imine.
| Compound Name | (2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidene-N-[(2-methyl-1,4-dioxan-2-yl)methyl]propan-1-imine |
|---|---|
| PubChem CID | 176762343 |
| Molecular Formula | C23H36N4O3S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (2Z)-3-[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2-hydrazinylidene-N-[(2-methyl-1,4-dioxan-2-yl)methyl]propan-1-imine |
| SMILES | CCc1cc2c(s1)CCO[C@@]21CCN(CC(/C=N/CC2(C)COCCO2)=N/N)[C@@H](C)C1 |
| InChI | InChI=1S/C23H36N4O3S/c1-4-19-11-20-21(31-19)5-8-30-23(20)6-7-27(17(2)12-23)14-18(26-24)13-25-15-22(3)16-28-9-10-29-22/h11,13,17H,4-10,12,14-16,24H2,1-3H3/b25-13+,26-18+/t17-,22?,23+/m0/s1 |
| InChIKey | NNDQDAPOJBONKW-TXHDJRNCSA-N |
| XLogP | 2.75 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|