C10H19NS — CID 169139896
5-ethenylsulfanyl-N,4-dimethylhex-5-en-2-amine (PubChem CID 169139896) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is 5-ethenylsulfanyl-N,4-dimethylhex-5-en-2-amine.
| Compound Name | 5-ethenylsulfanyl-N,4-dimethylhex-5-en-2-amine |
|---|---|
| PubChem CID | 169139896 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 5-ethenylsulfanyl-N,4-dimethylhex-5-en-2-amine |
| SMILES | C=CSC(=C)C(C)CC(C)NC |
| InChI | InChI=1S/C10H19NS/c1-6-12-10(4)8(2)7-9(3)11-5/h6,8-9,11H,1,4,7H2,2-3,5H3 |
| InChIKey | MGOLUFXZPMWLGD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |