C13H24FN3S — CID 169141920
N-[1-tert-butyl-3-(3-fluorocyclopentyl)pyrazol-5-yl]thiohydroxylamine;methane (PubChem CID 169141920) has the molecular formula C13H24FN3S and a molecular weight of 273.42 g/mol. Its IUPAC name is N-[1-tert-butyl-3-(3-fluorocyclopentyl)pyrazol-5-yl]thiohydroxylamine;methane.
| Compound Name | N-[1-tert-butyl-3-(3-fluorocyclopentyl)pyrazol-5-yl]thiohydroxylamine;methane |
|---|---|
| PubChem CID | 169141920 |
| Molecular Formula | C13H24FN3S |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N-[1-tert-butyl-3-(3-fluorocyclopentyl)pyrazol-5-yl]thiohydroxylamine;methane |
| SMILES | C.CC(C)(C)n1nc(C2CCC(F)C2)cc1NS |
| InChI | InChI=1S/C12H20FN3S.CH4/c1-12(2,3)16-11(15-17)7-10(14-16)8-4-5-9(13)6-8;/h7-9,15,17H,4-6H2,1-3H3;1H4 |
| InChIKey | RBFRFEAGZDDYLR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|