C23H26FN7O3 — CID 169142699
[(3S,4R,5S)-4-fluoro-5-[3-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-ylamino)-1H-pyrazol-5-yl]oxolan-3-yl] N-(1-bicyclo[1.1.1]pentanyl)carbamate (PubChem CID 169142699) has the molecular formula C23H26FN7O3 and a molecular weight of 467.51 g/mol. Its IUPAC name is [(3S,4R,5S)-4-fluoro-5-[3-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-ylamino)-1H-pyrazol-5-yl]oxolan-3-yl] N-(1-bicyclo[1.1.1]pentanyl)carbamate.
| Compound Name | [(3S,4R,5S)-4-fluoro-5-[3-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-ylamino)-1H-pyrazol-5-yl]oxolan-3-yl] N-(1-bicyclo[1.1.1]pentanyl)carbamate |
|---|---|
| PubChem CID | 169142699 |
| Molecular Formula | C23H26FN7O3 |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | [(3S,4R,5S)-4-fluoro-5-[3-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-ylamino)-1H-pyrazol-5-yl]oxolan-3-yl] N-(1-bicyclo[1.1.1]pentanyl)carbamate |
| SMILES | O=C(NC12CC(C1)C2)O[C@H]1CO[C@@H](c2cc(Nc3nccn4nc5c(c34)CCCC5)n[nH]2)[C@H]1F |
| InChI | InChI=1S/C23H26FN7O3/c24-18-16(34-22(32)27-23-8-12(9-23)10-23)11-33-20(18)15-7-17(29-28-15)26-21-19-13-3-1-2-4-14(13)30-31(19)6-5-25-21/h5-7,12,16,18,20H,1-4,8-11H2,(H,27,32)(H2,25,26,28,29)/t12?,16-,18-,20-,23?/m0/s1 |
| InChIKey | GWDTXFOJZKBPNW-IWVQINHHSA-N |
| XLogP | 3.13 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |