C10H19ClN4 — CID 169145998
N-[[3-(aminomethyl)-4-chloro-1-ethylpyrazol-5-yl]methyl]-N-methylethanamine (PubChem CID 169145998) has the molecular formula C10H19ClN4 and a molecular weight of 230.74 g/mol. Its IUPAC name is N-[[3-(aminomethyl)-4-chloro-1-ethylpyrazol-5-yl]methyl]-N-methylethanamine.
| Compound Name | N-[[3-(aminomethyl)-4-chloro-1-ethylpyrazol-5-yl]methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 169145998 |
| Molecular Formula | C10H19ClN4 |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | N-[[3-(aminomethyl)-4-chloro-1-ethylpyrazol-5-yl]methyl]-N-methylethanamine |
| SMILES | CCN(C)Cc1c(Cl)c(CN)nn1CC |
| InChI | InChI=1S/C10H19ClN4/c1-4-14(3)7-9-10(11)8(6-12)13-15(9)5-2/h4-7,12H2,1-3H3 |
| InChIKey | OIUXJSPLMQECMJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |