C13H23BrClN3 — CID 113499968
3-bromo-N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-N-methylbutan-1-amine (PubChem CID 113499968) has the molecular formula C13H23BrClN3 and a molecular weight of 336.71 g/mol. Its IUPAC name is 3-bromo-N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-N-methylbutan-1-amine.
| Compound Name | 3-bromo-N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 113499968 |
| Molecular Formula | C13H23BrClN3 |
| Molecular Weight | 336.71 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3-bromo-N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-N-methylbutan-1-amine |
| SMILES | CCc1nn(CC)c(CN(C)CCC(C)Br)c1Cl |
| InChI | InChI=1S/C13H23BrClN3/c1-5-11-13(15)12(18(6-2)16-11)9-17(4)8-7-10(3)14/h10H,5-9H2,1-4H3 |
| InChIKey | MCBTWEGWTWNPJV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.71 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|