C14H24Cl2N2 — CID 83152816
4-chloro-5-[2-(chloromethyl)-2,3-dimethylbutyl]-1,3-diethylpyrazole (PubChem CID 83152816) has the molecular formula C14H24Cl2N2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 4-chloro-5-[2-(chloromethyl)-2,3-dimethylbutyl]-1,3-diethylpyrazole.
| Compound Name | 4-chloro-5-[2-(chloromethyl)-2,3-dimethylbutyl]-1,3-diethylpyrazole |
|---|---|
| PubChem CID | 83152816 |
| Molecular Formula | C14H24Cl2N2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-chloro-5-[2-(chloromethyl)-2,3-dimethylbutyl]-1,3-diethylpyrazole |
| SMILES | CCc1nn(CC)c(CC(C)(CCl)C(C)C)c1Cl |
| InChI | InChI=1S/C14H24Cl2N2/c1-6-11-13(16)12(18(7-2)17-11)8-14(5,9-15)10(3)4/h10H,6-9H2,1-5H3 |
| InChIKey | JWIPLLXEMAZNLZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|