C13H21ClN2O — CID 102641943
2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-methylbut-3-en-1-ol (PubChem CID 102641943) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-methylbut-3-en-1-ol.
| Compound Name | 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 102641943 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-methylbut-3-en-1-ol |
| SMILES | C=CC(C)(CO)Cc1c(Cl)c(CC)nn1CC |
| InChI | InChI=1S/C13H21ClN2O/c1-5-10-12(14)11(16(7-3)15-10)8-13(4,6-2)9-17/h6,17H,2,5,7-9H2,1,3-4H3 |
| InChIKey | JBWZHYMFXBYCSW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|