C18H15ClN4O — CID 169147481
4-[[(8-chloro-1-methyl-2-oxo-1,7-naphthyridin-3-yl)methylamino]methyl]benzonitrile (PubChem CID 169147481) has the molecular formula C18H15ClN4O and a molecular weight of 338.80 g/mol. Its IUPAC name is 4-[[(8-chloro-1-methyl-2-oxo-1,7-naphthyridin-3-yl)methylamino]methyl]benzonitrile.
| Compound Name | 4-[[(8-chloro-1-methyl-2-oxo-1,7-naphthyridin-3-yl)methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 169147481 |
| Molecular Formula | C18H15ClN4O |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-[[(8-chloro-1-methyl-2-oxo-1,7-naphthyridin-3-yl)methylamino]methyl]benzonitrile |
| SMILES | Cn1c(=O)c(CNCc2ccc(C#N)cc2)cc2ccnc(Cl)c21 |
| InChI | InChI=1S/C18H15ClN4O/c1-23-16-14(6-7-22-17(16)19)8-15(18(23)24)11-21-10-13-4-2-12(9-20)3-5-13/h2-8,21H,10-11H2,1H3 |
| InChIKey | OAXFJGBTWQVNIC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|