C26H31FN4O3 — CID 169148226
N-[1-(4-fluoro-3-methoxyanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide (PubChem CID 169148226) has the molecular formula C26H31FN4O3 and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[1-(4-fluoro-3-methoxyanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide.
| Compound Name | N-[1-(4-fluoro-3-methoxyanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide |
|---|---|
| PubChem CID | 169148226 |
| Molecular Formula | C26H31FN4O3 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-[1-(4-fluoro-3-methoxyanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide |
| SMILES | COc1cc(Nc2nccc3cc(OC)c(NC(=O)CCCN4CCCCC4)cc23)ccc1F |
| InChI | InChI=1S/C26H31FN4O3/c1-33-23-16-19(8-9-21(23)27)29-26-20-17-22(24(34-2)15-18(20)10-11-28-26)30-25(32)7-6-14-31-12-4-3-5-13-31/h8-11,15-17H,3-7,12-14H2,1-2H3,(H,28,29)(H,30,32) |
| InChIKey | FYBXKTYHKKIMCU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |