About N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide
N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide (PubChem CID 169148268) has the molecular formula C25H28Cl2N4O2
and a molecular weight of 487.43 g/mol. Its IUPAC name is N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide.
Molecular Properties
| Compound Name | N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide |
| PubChem CID | 169148268 |
| Molecular Formula | C25H28Cl2N4O2 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide |
| SMILES | COc1cc2ccnc(Nc3ccc(Cl)c(Cl)c3)c2cc1NC(=O)CCCN1CCCCC1 |
| InChI | InChI=1S/C25H28Cl2N4O2/c1-33-23-14-17-9-10-28-25(29-18-7-8-20(26)21(27)15-18)19(17)16-22(23)30-24(32)6-5-13-31-11-3-2-4-12-31/h7-10,14-16H,2-6,11-13H2,1H3,(H,28,29)(H,30,32) |
| InChIKey | ICIUWDZYOFVDSS-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide?
The IUPAC name of N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide (CID 169148268) is N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide.
What is the SMILES notation for N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide?
The canonical SMILES for N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide is COc1cc2ccnc(Nc3ccc(Cl)c(Cl)c3)c2cc1NC(=O)CCCN1CCCCC1.
What is the InChIKey of N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide?
The InChIKey is ICIUWDZYOFVDSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28Cl2N4O2/c1-33-23-14-17-9-10-28-25(29-18-7-8-20(26)21(27)15-18)19(17)16-22(23)30-24(32)6-5-13-31-11-3-2-4-12-31/h7-10,14-16H,2-6,11-13H2,1H3,(H,28,29)(H,30,32).
What are the key properties of N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide?
N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide has a molecular weight of 487.43 g/mol, XLogP of 6.50, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-dichloroanilino)-6-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide is sourced from PubChem (CID 169148268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).