C11H13F3N2O — CID 169148618
6-pyrrolidin-3-yl-3-(2,2,2-trifluoroethyl)-1H-pyridin-2-one (PubChem CID 169148618) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 6-pyrrolidin-3-yl-3-(2,2,2-trifluoroethyl)-1H-pyridin-2-one.
| Compound Name | 6-pyrrolidin-3-yl-3-(2,2,2-trifluoroethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 169148618 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 6-pyrrolidin-3-yl-3-(2,2,2-trifluoroethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(C2CCNC2)ccc1CC(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O/c12-11(13,14)5-7-1-2-9(16-10(7)17)8-3-4-15-6-8/h1-2,8,15H,3-6H2,(H,16,17) |
| InChIKey | HHWZDNMNBNVQMW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |