C10H9F3N2O — CID 143235787
2-(trifluoromethyl)-1,6,7,9a-tetrahydropyrido[3,2-c]azepin-5-one (PubChem CID 143235787) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is 2-(trifluoromethyl)-1,6,7,9a-tetrahydropyrido[3,2-c]azepin-5-one.
| Compound Name | 2-(trifluoromethyl)-1,6,7,9a-tetrahydropyrido[3,2-c]azepin-5-one |
|---|---|
| PubChem CID | 143235787 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-(trifluoromethyl)-1,6,7,9a-tetrahydropyrido[3,2-c]azepin-5-one |
| SMILES | O=C1NCC=CC2NC(C(F)(F)F)=CC=C12 |
| InChI | InChI=1S/C10H9F3N2O/c11-10(12,13)8-4-3-6-7(15-8)2-1-5-14-9(6)16/h1-4,7,15H,5H2,(H,14,16) |
| InChIKey | PCLQGBAVZNYQHQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|