C8H9F3N2O — CID 67124055
3-(aminomethyl)-6-methyl-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 67124055) has the molecular formula C8H9F3N2O and a molecular weight of 206.17 g/mol. Its IUPAC name is 3-(aminomethyl)-6-methyl-4-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 3-(aminomethyl)-6-methyl-4-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 67124055 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-(aminomethyl)-6-methyl-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | Cc1cc(C(F)(F)F)c(CN)c(=O)[nH]1 |
| InChI | InChI=1S/C8H9F3N2O/c1-4-2-6(8(9,10)11)5(3-12)7(14)13-4/h2H,3,12H2,1H3,(H,13,14) |
| InChIKey | WQHDTHDJPDGYLZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |