C25H39N7O — CID 169150833
2-(6-cyclobutyl-3-pyridinyl)propan-2-amine;ethane;3-methoxy-N'-[(Z)-(methylhydrazinylidene)methyl]-2-(methylideneamino)benzenecarboximidamide (PubChem CID 169150833) has the molecular formula C25H39N7O and a molecular weight of 453.64 g/mol. Its IUPAC name is 2-(6-cyclobutyl-3-pyridinyl)propan-2-amine;ethane;3-methoxy-N'-[(Z)-(methylhydrazinylidene)methyl]-2-(methylideneamino)benzenecarboximidamide.
| Compound Name | 2-(6-cyclobutyl-3-pyridinyl)propan-2-amine;ethane;3-methoxy-N'-[(Z)-(methylhydrazinylidene)methyl]-2-(methylideneamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 169150833 |
| Molecular Formula | C25H39N7O |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | 2-(6-cyclobutyl-3-pyridinyl)propan-2-amine;ethane;3-methoxy-N'-[(Z)-(methylhydrazinylidene)methyl]-2-(methylideneamino)benzenecarboximidamide |
| SMILES | C=Nc1c(OC)cccc1/C(N)=N/C=N\NC.CC.CC(C)(N)c1ccc(C2CCC2)nc1 |
| InChI | InChI=1S/C12H18N2.C11H15N5O.C2H6/c1-12(2,13)10-6-7-11(14-8-10)9-4-3-5-9;1-13-10-8(5-4-6-9(10)17-3)11(12)15-7-16-14-2;1-2/h6-9H,3-5,13H2,1-2H3;4-7,14H,1H2,2-3H3,(H2,12,15,16);1-2H3 |
| InChIKey | FUZGVABFCYBIBV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|