C23H36Br2O3 — CID 169153738
2-bromo-1-[(3R,5S,8R,9S,10S,13S,14S)-17-bromo-3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 169153738) has the molecular formula C23H36Br2O3 and a molecular weight of 520.35 g/mol. Its IUPAC name is 2-bromo-1-[(3R,5S,8R,9S,10S,13S,14S)-17-bromo-3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-bromo-1-[(3R,5S,8R,9S,10S,13S,14S)-17-bromo-3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 169153738 |
| Molecular Formula | C23H36Br2O3 |
| Molecular Weight | 520.35 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 2-bromo-1-[(3R,5S,8R,9S,10S,13S,14S)-17-bromo-3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | COC[C@@]1(O)CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3CCC2(Br)C(=O)CBr)C1 |
| InChI | InChI=1S/C23H36Br2O3/c1-20-10-11-22(27,14-28-3)12-15(20)4-5-16-17(20)6-8-21(2)18(16)7-9-23(21,25)19(26)13-24/h15-18,27H,4-14H2,1-3H3/t15-,16+,17-,18-,20-,21-,22+,23?/m0/s1 |
| InChIKey | QVCPTMCMMPLWDR-TXFMULCTSA-N |
| XLogP | 5.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.35 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|