C25H39BrO4 — CID 87631951
1-[(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-bromoethanone (PubChem CID 87631951) has the molecular formula C25H39BrO4 and a molecular weight of 483.49 g/mol. Its IUPAC name is 1-[(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-bromoethanone.
| Compound Name | 1-[(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-bromoethanone |
|---|---|
| PubChem CID | 87631951 |
| Molecular Formula | C25H39BrO4 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 1-[(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-bromoethanone |
| SMILES | COC[C@@]1(O)CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3CC[C@]2(C(C)=O)C(=O)CBr)C1 |
| InChI | InChI=1S/C25H39BrO4/c1-16(27)25(21(28)14-26)10-8-20-18-6-5-17-13-24(29,15-30-4)12-11-22(17,2)19(18)7-9-23(20,25)3/h17-20,29H,5-15H2,1-4H3/t17-,18+,19-,20-,22-,23-,24+,25-/m0/s1 |
| InChIKey | IMYCDPDCVHFQAY-HCKRFQOESA-N |
| XLogP | 4.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|