C12H11B3N2O3 — CID 169153769
CID 169153769 (PubChem CID 169153769) has the molecular formula C12H11B3N2O3 and a molecular weight of 263.67 g/mol.
| Compound Name | CID 169153769 |
|---|---|
| PubChem CID | 169153769 |
| Molecular Formula | C12H11B3N2O3 |
| Molecular Weight | 263.67 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | — |
| SMILES | [B]C1(CO)N=C(C2COc3ccccc3O2)NC1([B])[B] |
| InChI | InChI=1S/C12H11B3N2O3/c13-11(6-18)12(14,15)17-10(16-11)9-5-19-7-3-1-2-4-8(7)20-9/h1-4,9,18H,5-6H2,(H,16,17) |
| InChIKey | IJLHFXVLMUDMQN-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.67 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|