C9H13N3O — CID 169156016
azetidin-1-yl-(1,4-dimethylpyrazol-5-yl)methanone (PubChem CID 169156016) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is azetidin-1-yl-(1,4-dimethylpyrazol-5-yl)methanone.
| Compound Name | azetidin-1-yl-(1,4-dimethylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 169156016 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | azetidin-1-yl-(1,4-dimethylpyrazol-5-yl)methanone |
| SMILES | Cc1cnn(C)c1C(=O)N1CCC1 |
| InChI | InChI=1S/C9H13N3O/c1-7-6-10-11(2)8(7)9(13)12-4-3-5-12/h6H,3-5H2,1-2H3 |
| InChIKey | GRGOZOCTHABZHT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |