C16H22FNO4 — CID 169157068
methyl 2-[2-fluoro-4-[2-[(2R)-2-methylmorpholin-4-yl]ethoxy]phenyl]acetate (PubChem CID 169157068) has the molecular formula C16H22FNO4 and a molecular weight of 311.35 g/mol. Its IUPAC name is methyl 2-[2-fluoro-4-[2-[(2R)-2-methylmorpholin-4-yl]ethoxy]phenyl]acetate.
| Compound Name | methyl 2-[2-fluoro-4-[2-[(2R)-2-methylmorpholin-4-yl]ethoxy]phenyl]acetate |
|---|---|
| PubChem CID | 169157068 |
| Molecular Formula | C16H22FNO4 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | methyl 2-[2-fluoro-4-[2-[(2R)-2-methylmorpholin-4-yl]ethoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OCCN2CCO[C@H](C)C2)cc1F |
| InChI | InChI=1S/C16H22FNO4/c1-12-11-18(5-7-21-12)6-8-22-14-4-3-13(15(17)10-14)9-16(19)20-2/h3-4,10,12H,5-9,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | FGWNQZADQUMHSZ-GFCCVEGCSA-N |
| XLogP | 1.64 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |