C22H21ClN4O2 — CID 169158001
6-chloro-4-methyl-3-[3-(4-methylphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-1H-1,5-naphthyridin-2-one (PubChem CID 169158001) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is 6-chloro-4-methyl-3-[3-(4-methylphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-1H-1,5-naphthyridin-2-one.
| Compound Name | 6-chloro-4-methyl-3-[3-(4-methylphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 169158001 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 6-chloro-4-methyl-3-[3-(4-methylphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-1H-1,5-naphthyridin-2-one |
| SMILES | CCC(=O)N1N=C(c2c(C)c3nc(Cl)ccc3[nH]c2=O)CC1c1ccc(C)cc1 |
| InChI | InChI=1S/C22H21ClN4O2/c1-4-19(28)27-17(14-7-5-12(2)6-8-14)11-16(26-27)20-13(3)21-15(24-22(20)29)9-10-18(23)25-21/h5-10,17H,4,11H2,1-3H3,(H,24,29) |
| InChIKey | BPSJXOIVGWJAGU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|