C33H47F3N4O5 — CID 169158608
tert-butyl 4-[2-[(1R,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]cyclopent-2-en-1-yl]ethyl]piperidine-1-carboxylate (PubChem CID 169158608) has the molecular formula C33H47F3N4O5 and a molecular weight of 636.76 g/mol. Its IUPAC name is tert-butyl 4-[2-[(1R,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]cyclopent-2-en-1-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(1R,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]cyclopent-2-en-1-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169158608 |
| Molecular Formula | C33H47F3N4O5 |
| Molecular Weight | 636.76 g/mol |
| Exact Mass | 636.35 |
| IUPAC Name | tert-butyl 4-[2-[(1R,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]cyclopent-2-en-1-yl]ethyl]piperidine-1-carboxylate |
| SMILES | CO[C@@H]1COCC[C@@H]1N[C@@H]1C=C[C@](CCC2CCN(C(=O)OC(C)(C)C)CC2)(C(=O)N2CCc3ncc(C(F)(F)F)cc3C2)C1 |
| InChI | InChI=1S/C33H47F3N4O5/c1-31(2,3)45-30(42)39-13-7-22(8-14-39)5-11-32(12-6-25(18-32)38-27-10-16-44-21-28(27)43-4)29(41)40-15-9-26-23(20-40)17-24(19-37-26)33(34,35)36/h6,12,17,19,22,25,27-28,38H,5,7-11,13-16,18,20-21H2,1-4H3/t25-,27+,28-,32+/m1/s1 |
| InChIKey | WQRQWWBDFGLIAQ-AJFCMVSNSA-N |
| XLogP | 5.12 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.76 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|