C19H28N6S — CID 169160007
1-[1-[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]pyrrolidin-3-yl]propane-2-thiol (PubChem CID 169160007) has the molecular formula C19H28N6S and a molecular weight of 372.54 g/mol. Its IUPAC name is 1-[1-[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]pyrrolidin-3-yl]propane-2-thiol.
| Compound Name | 1-[1-[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]pyrrolidin-3-yl]propane-2-thiol |
|---|---|
| PubChem CID | 169160007 |
| Molecular Formula | C19H28N6S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 1-[1-[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]pyrrolidin-3-yl]propane-2-thiol |
| SMILES | CC(S)CC1CCN(c2nccc(Nc3cc(C4CCCC4)[nH]n3)n2)C1 |
| InChI | InChI=1S/C19H28N6S/c1-13(26)10-14-7-9-25(12-14)19-20-8-6-17(22-19)21-18-11-16(23-24-18)15-4-2-3-5-15/h6,8,11,13-15,26H,2-5,7,9-10,12H2,1H3,(H2,20,21,22,23,24) |
| InChIKey | ULTXCNHLYRLKPC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|