C21H32N6 — CID 169170155
N-(5-cyclopentyl-1H-pyrazol-3-yl)-2-[3-(2-methylbutyl)pyrrolidin-1-yl]pyrimidin-4-amine (PubChem CID 169170155) has the molecular formula C21H32N6 and a molecular weight of 368.53 g/mol. Its IUPAC name is N-(5-cyclopentyl-1H-pyrazol-3-yl)-2-[3-(2-methylbutyl)pyrrolidin-1-yl]pyrimidin-4-amine.
| Compound Name | N-(5-cyclopentyl-1H-pyrazol-3-yl)-2-[3-(2-methylbutyl)pyrrolidin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 169170155 |
| Molecular Formula | C21H32N6 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | N-(5-cyclopentyl-1H-pyrazol-3-yl)-2-[3-(2-methylbutyl)pyrrolidin-1-yl]pyrimidin-4-amine |
| SMILES | CCC(C)CC1CCN(c2nccc(Nc3cc(C4CCCC4)[nH]n3)n2)C1 |
| InChI | InChI=1S/C21H32N6/c1-3-15(2)12-16-9-11-27(14-16)21-22-10-8-19(24-21)23-20-13-18(25-26-20)17-6-4-5-7-17/h8,10,13,15-17H,3-7,9,11-12,14H2,1-2H3,(H2,22,23,24,25,26) |
| InChIKey | SEXRHQWNFZPXEL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |