C24H16F3NO3 — CID 169162649
methyl 3-[3-[4-phenyl-3-(trifluoromethyl)phenyl]prop-2-ynoylamino]benzoate (PubChem CID 169162649) has the molecular formula C24H16F3NO3 and a molecular weight of 423.39 g/mol. Its IUPAC name is methyl 3-[3-[4-phenyl-3-(trifluoromethyl)phenyl]prop-2-ynoylamino]benzoate.
| Compound Name | methyl 3-[3-[4-phenyl-3-(trifluoromethyl)phenyl]prop-2-ynoylamino]benzoate |
|---|---|
| PubChem CID | 169162649 |
| Molecular Formula | C24H16F3NO3 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | methyl 3-[3-[4-phenyl-3-(trifluoromethyl)phenyl]prop-2-ynoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)C#Cc2ccc(-c3ccccc3)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C24H16F3NO3/c1-31-23(30)18-8-5-9-19(15-18)28-22(29)13-11-16-10-12-20(17-6-3-2-4-7-17)21(14-16)24(25,26)27/h2-10,12,14-15H,1H3,(H,28,29) |
| InChIKey | XHLQHFVLGVLYOF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|