C19H16F3NOS — CID 169162550
N-(2-methylsulfanylethyl)-3-[4-phenyl-3-(trifluoromethyl)phenyl]prop-2-ynamide (PubChem CID 169162550) has the molecular formula C19H16F3NOS and a molecular weight of 363.40 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-3-[4-phenyl-3-(trifluoromethyl)phenyl]prop-2-ynamide.
| Compound Name | N-(2-methylsulfanylethyl)-3-[4-phenyl-3-(trifluoromethyl)phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 169162550 |
| Molecular Formula | C19H16F3NOS |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-(2-methylsulfanylethyl)-3-[4-phenyl-3-(trifluoromethyl)phenyl]prop-2-ynamide |
| SMILES | CSCCNC(=O)C#Cc1ccc(-c2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3NOS/c1-25-12-11-23-18(24)10-8-14-7-9-16(15-5-3-2-4-6-15)17(13-14)19(20,21)22/h2-7,9,13H,11-12H2,1H3,(H,23,24) |
| InChIKey | XFJDDQHIYONJSD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|