C23H25F2N — CID 169162595
(Z)-N-[(2S)-butan-2-yl]-1-[3-(1,1-difluoroethyl)-4-phenylphenyl]pent-3-en-1-yn-3-amine (PubChem CID 169162595) has the molecular formula C23H25F2N and a molecular weight of 353.46 g/mol. Its IUPAC name is (Z)-N-[(2S)-butan-2-yl]-1-[3-(1,1-difluoroethyl)-4-phenylphenyl]pent-3-en-1-yn-3-amine.
| Compound Name | (Z)-N-[(2S)-butan-2-yl]-1-[3-(1,1-difluoroethyl)-4-phenylphenyl]pent-3-en-1-yn-3-amine |
|---|---|
| PubChem CID | 169162595 |
| Molecular Formula | C23H25F2N |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (Z)-N-[(2S)-butan-2-yl]-1-[3-(1,1-difluoroethyl)-4-phenylphenyl]pent-3-en-1-yn-3-amine |
| SMILES | C/C=C(/C#Cc1ccc(-c2ccccc2)c(C(C)(F)F)c1)N[C@@H](C)CC |
| InChI | InChI=1S/C23H25F2N/c1-5-17(3)26-20(6-2)14-12-18-13-15-21(19-10-8-7-9-11-19)22(16-18)23(4,24)25/h6-11,13,15-17,26H,5H2,1-4H3/b20-6-/t17-/m0/s1 |
| InChIKey | QTVAOJSJZJIFSU-NAQWSFMZSA-N |
| XLogP | 6.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|