About 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium
3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium (PubChem CID 169162556) has the molecular formula C17H12F2V
and a molecular weight of 305.22 g/mol. Its IUPAC name is 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium.
Molecular Properties
| Compound Name | 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium |
| PubChem CID | 169162556 |
| Molecular Formula | C17H12F2V |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium |
| SMILES | CC(F)(F)c1cc(C#CC=[V])ccc1-c1ccccc1 |
| InChI | InChI=1S/C17H12F2.V/c1-3-7-13-10-11-15(14-8-5-4-6-9-14)16(12-13)17(2,18)19;/h1,4-6,8-12H,2H3; |
| InChIKey | PEJBAUQOLJBNOG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium?
The IUPAC name of 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium (CID 169162556) is 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium.
What is the SMILES notation for 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium?
The canonical SMILES for 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium is CC(F)(F)c1cc(C#CC=[V])ccc1-c1ccccc1.
What is the InChIKey of 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium?
The InChIKey is PEJBAUQOLJBNOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F2.V/c1-3-7-13-10-11-15(14-8-5-4-6-9-14)16(12-13)17(2,18)19;/h1,4-6,8-12H,2H3;.
What are the key properties of 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium?
3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium has a molecular weight of 305.22 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(1,1-difluoroethyl)-4-phenylphenyl]prop-2-ynylidenevanadium is sourced from PubChem (CID 169162556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).