C18H13ClF3NO — CID 68945575
3-(3-chlorophenyl)-N-[2-[2-(trifluoromethyl)phenyl]ethyl]prop-2-ynamide (PubChem CID 68945575) has the molecular formula C18H13ClF3NO and a molecular weight of 351.76 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[2-[2-(trifluoromethyl)phenyl]ethyl]prop-2-ynamide.
| Compound Name | 3-(3-chlorophenyl)-N-[2-[2-(trifluoromethyl)phenyl]ethyl]prop-2-ynamide |
|---|---|
| PubChem CID | 68945575 |
| Molecular Formula | C18H13ClF3NO |
| Molecular Weight | 351.76 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[2-[2-(trifluoromethyl)phenyl]ethyl]prop-2-ynamide |
| SMILES | O=C(C#Cc1cccc(Cl)c1)NCCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H13ClF3NO/c19-15-6-3-4-13(12-15)8-9-17(24)23-11-10-14-5-1-2-7-16(14)18(20,21)22/h1-7,12H,10-11H2,(H,23,24) |
| InChIKey | QXKLWEKXHXUQEF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.76 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|