C17H12Cl3NO — CID 68945819
N-[2-(3-chlorophenyl)ethyl]-3-(3,5-dichlorophenyl)prop-2-ynamide (PubChem CID 68945819) has the molecular formula C17H12Cl3NO and a molecular weight of 352.65 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-3-(3,5-dichlorophenyl)prop-2-ynamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-3-(3,5-dichlorophenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 68945819 |
| Molecular Formula | C17H12Cl3NO |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-3-(3,5-dichlorophenyl)prop-2-ynamide |
| SMILES | O=C(C#Cc1cc(Cl)cc(Cl)c1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H12Cl3NO/c18-14-3-1-2-12(8-14)6-7-21-17(22)5-4-13-9-15(19)11-16(20)10-13/h1-3,8-11H,6-7H2,(H,21,22) |
| InChIKey | ZIRVKOWIQDFHDV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|