C18H12Cl2F3NO — CID 68941475
N-[2-(3,4-dichlorophenyl)ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide (PubChem CID 68941475) has the molecular formula C18H12Cl2F3NO and a molecular weight of 386.20 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 68941475 |
| Molecular Formula | C18H12Cl2F3NO |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide |
| SMILES | O=C(C#Cc1ccc(C(F)(F)F)cc1)NCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H12Cl2F3NO/c19-15-7-3-13(11-16(15)20)9-10-24-17(25)8-4-12-1-5-14(6-2-12)18(21,22)23/h1-3,5-7,11H,9-10H2,(H,24,25) |
| InChIKey | XISXFVXTCCTARU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|