C18H13FN4O2S — CID 169164516
[(4S)-4-(5-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 169164516) has the molecular formula C18H13FN4O2S and a molecular weight of 368.39 g/mol. Its IUPAC name is [(4S)-4-(5-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(4S)-4-(5-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 169164516 |
| Molecular Formula | C18H13FN4O2S |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | [(4S)-4-(5-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)N1CCc2[nH]cnc2[C@H]1c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C18H13FN4O2S/c19-11-1-2-13-10(7-11)8-14(25-13)16-15-12(21-9-22-15)3-5-23(16)18(24)17-20-4-6-26-17/h1-2,4,6-9,16H,3,5H2,(H,21,22)/t16-/m1/s1 |
| InChIKey | SUZUSXHOAQICKM-MRXNPFEDSA-N |
| XLogP | 3.54 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |