C19H15FN4O2S — CID 177297459
[(4S)-4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 177297459) has the molecular formula C19H15FN4O2S and a molecular weight of 382.42 g/mol. Its IUPAC name is [(4S)-4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(4S)-4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 177297459 |
| Molecular Formula | C19H15FN4O2S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [(4S)-4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | Cc1c([C@@H]2c3nc[nH]c3CCN2C(=O)c2nccs2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C19H15FN4O2S/c1-10-12-8-11(20)2-3-14(12)26-17(10)16-15-13(22-9-23-15)4-6-24(16)19(25)18-21-5-7-27-18/h2-3,5,7-9,16H,4,6H2,1H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | IZTSVCUEWRHNAG-INIZCTEOSA-N |
| XLogP | 3.85 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |