C37H33ClFN8O3Si — CID 169168614
CID 169168614 (PubChem CID 169168614) has the molecular formula C37H33ClFN8O3Si and a molecular weight of 720.26 g/mol.
| Compound Name | CID 169168614 |
|---|---|
| PubChem CID | 169168614 |
| Molecular Formula | C37H33ClFN8O3Si |
| Molecular Weight | 720.26 g/mol |
| Exact Mass | 719.21 |
| IUPAC Name | — |
| SMILES | Cc1[nH]nc2ncc(NC(=O)c3ccc4c(c3)nc(CN3CC=C(c5cccc(OCc6ccc(Cl)cc6F)n5)CC3)n4C[C@]3([Si])CCO3)cc12 |
| InChI | InChI=1S/C37H33ClFN8O3Si/c1-22-28-17-27(18-40-35(28)45-44-22)41-36(48)24-6-8-32-31(15-24)42-33(47(32)21-37(51)11-14-50-37)19-46-12-9-23(10-13-46)30-3-2-4-34(43-30)49-20-25-5-7-26(38)16-29(25)39/h2-9,15-18H,10-14,19-21H2,1H3,(H,41,48)(H,40,44,45)/t37-/m1/s1 |
| InChIKey | DGHYYHYLTZOKEF-DIPNUNPCSA-N |
| XLogP | 6.21 |
| TPSA | 123.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.26 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|