C38H34ClFN7O3Si — CID 169169178
CID 169169178 (PubChem CID 169169178) has the molecular formula C38H34ClFN7O3Si and a molecular weight of 719.27 g/mol.
| Compound Name | CID 169169178 |
|---|---|
| PubChem CID | 169169178 |
| Molecular Formula | C38H34ClFN7O3Si |
| Molecular Weight | 719.27 g/mol |
| Exact Mass | 718.22 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(=O)Nc2ccc3c(c2)nc(CN2CC=C(c4cccc(OCc5ccc(Cl)cc5F)n4)CC2)n3C[C@]2([Si])CCO2)cc2cn[nH]c12 |
| InChI | InChI=1S/C38H34ClFN7O3Si/c1-23-15-26(16-27-19-41-45-36(23)27)37(48)42-29-7-8-33-32(18-29)43-34(47(33)22-38(51)11-14-50-38)20-46-12-9-24(10-13-46)31-3-2-4-35(44-31)49-21-25-5-6-28(39)17-30(25)40/h2-9,15-19H,10-14,20-22H2,1H3,(H,41,45)(H,42,48)/t38-/m1/s1 |
| InChIKey | FZOJASWKPXOOPY-KXQOOQHDSA-N |
| XLogP | 6.81 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.27 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|