C21H36N6 — CID 169170223
(Z)-N'-[(E)-1-[3-aminopropyl(methyl)amino]pent-1-enyl]-N-(5-cyclopropyl-1H-pyrazol-3-yl)but-2-enimidamide;ethene (PubChem CID 169170223) has the molecular formula C21H36N6 and a molecular weight of 372.56 g/mol. Its IUPAC name is (Z)-N'-[(E)-1-[3-aminopropyl(methyl)amino]pent-1-enyl]-N-(5-cyclopropyl-1H-pyrazol-3-yl)but-2-enimidamide;ethene.
| Compound Name | (Z)-N'-[(E)-1-[3-aminopropyl(methyl)amino]pent-1-enyl]-N-(5-cyclopropyl-1H-pyrazol-3-yl)but-2-enimidamide;ethene |
|---|---|
| PubChem CID | 169170223 |
| Molecular Formula | C21H36N6 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (Z)-N'-[(E)-1-[3-aminopropyl(methyl)amino]pent-1-enyl]-N-(5-cyclopropyl-1H-pyrazol-3-yl)but-2-enimidamide;ethene |
| SMILES | C/C=C\C(=N/C(=C/CCC)N(C)CCCN)Nc1cc(C2CC2)[nH]n1.C=C |
| InChI | InChI=1S/C19H32N6.C2H4/c1-4-6-9-19(25(3)13-7-12-20)22-17(8-5-2)21-18-14-16(23-24-18)15-10-11-15;1-2/h5,8-9,14-15H,4,6-7,10-13,20H2,1-3H3,(H2,21,22,23,24);1-2H2/b8-5-,19-9-; |
| InChIKey | XOQPQMCMQGMUHJ-YMJJXDTPSA-N |
| XLogP | 4.40 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|