C22H38N6 — CID 169170308
(Z)-N-(5-cyclopropyl-1H-pyrazol-3-yl)-N'-[(E)-1-[methyl-[3-(methylamino)propyl]amino]pent-1-enyl]but-2-enimidamide;ethene (PubChem CID 169170308) has the molecular formula C22H38N6 and a molecular weight of 386.59 g/mol. Its IUPAC name is (Z)-N-(5-cyclopropyl-1H-pyrazol-3-yl)-N'-[(E)-1-[methyl-[3-(methylamino)propyl]amino]pent-1-enyl]but-2-enimidamide;ethene.
| Compound Name | (Z)-N-(5-cyclopropyl-1H-pyrazol-3-yl)-N'-[(E)-1-[methyl-[3-(methylamino)propyl]amino]pent-1-enyl]but-2-enimidamide;ethene |
|---|---|
| PubChem CID | 169170308 |
| Molecular Formula | C22H38N6 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | (Z)-N-(5-cyclopropyl-1H-pyrazol-3-yl)-N'-[(E)-1-[methyl-[3-(methylamino)propyl]amino]pent-1-enyl]but-2-enimidamide;ethene |
| SMILES | C/C=C\C(=N/C(=C/CCC)N(C)CCCNC)Nc1cc(C2CC2)[nH]n1.C=C |
| InChI | InChI=1S/C20H34N6.C2H4/c1-5-7-10-20(26(4)14-8-13-21-3)23-18(9-6-2)22-19-15-17(24-25-19)16-11-12-16;1-2/h6,9-10,15-16,21H,5,7-8,11-14H2,1-4H3,(H2,22,23,24,25);1-2H2/b9-6-,20-10-; |
| InChIKey | SDJNUABNHUYOIE-CTNASQEGSA-N |
| XLogP | 4.66 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|