About cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine
cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine (PubChem CID 169170232) has the molecular formula C17H30N2
and a molecular weight of 262.44 g/mol. Its IUPAC name is cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine.
Molecular Properties
| Compound Name | cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine |
| PubChem CID | 169170232 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine |
| SMILES | C/C=C\C(C)=N/C(=C/CCC)N1CCCC1.C1CC1 |
| InChI | InChI=1S/C14H24N2.C3H6/c1-4-6-10-14(15-13(3)9-5-2)16-11-7-8-12-16;1-2-3-1/h5,9-10H,4,6-8,11-12H2,1-3H3;1-3H2/b9-5-,14-10-,15-13-; |
| InChIKey | AAXZHAJQYBSFPS-HUDYADEPSA-N |
| XLogP | 4.93 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine?
The IUPAC name of cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine (CID 169170232) is cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine.
What is the SMILES notation for cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine?
The canonical SMILES for cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine is C/C=C\C(C)=N/C(=C/CCC)N1CCCC1.C1CC1.
What is the InChIKey of cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine?
The InChIKey is AAXZHAJQYBSFPS-HUDYADEPSA-N. The full InChI is InChI=1S/C14H24N2.C3H6/c1-4-6-10-14(15-13(3)9-5-2)16-11-7-8-12-16;1-2-3-1/h5,9-10H,4,6-8,11-12H2,1-3H3;1-3H2/b9-5-,14-10-,15-13-;.
What are the key properties of cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine?
cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine has a molecular weight of 262.44 g/mol, XLogP of 4.93, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;(Z,Z)-N-[(E)-1-pyrrolidin-1-ylpent-1-enyl]pent-3-en-2-imine is sourced from PubChem (CID 169170232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).