C13H24O2 — CID 169171976
2-(7-methyl-3-methylideneoctyl)-1,3-dioxolane (PubChem CID 169171976) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-(7-methyl-3-methylideneoctyl)-1,3-dioxolane.
| Compound Name | 2-(7-methyl-3-methylideneoctyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 169171976 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-(7-methyl-3-methylideneoctyl)-1,3-dioxolane |
| SMILES | C=C(CCCC(C)C)CCC1OCCO1 |
| InChI | InChI=1S/C13H24O2/c1-11(2)5-4-6-12(3)7-8-13-14-9-10-15-13/h11,13H,3-10H2,1-2H3 |
| InChIKey | POHFUZIQMILKPW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|