C10H19BrO2Zn — CID 24822226
bromozinc(1+);2-[(3R)-3-methylhexyl]-1,3-dioxolane (PubChem CID 24822226) has the molecular formula C10H19BrO2Zn and a molecular weight of 316.55 g/mol. Its IUPAC name is bromozinc(1+);2-[(3R)-3-methylhexyl]-1,3-dioxolane.
| Compound Name | bromozinc(1+);2-[(3R)-3-methylhexyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 24822226 |
| Molecular Formula | C10H19BrO2Zn |
| Molecular Weight | 316.55 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | bromozinc(1+);2-[(3R)-3-methylhexyl]-1,3-dioxolane |
| SMILES | [CH2-]CC[C@@H](C)CCC1OCCO1.[Zn+]Br |
| InChI | InChI=1S/C10H19O2.BrH.Zn/c1-3-4-9(2)5-6-10-11-7-8-12-10;;/h9-10H,1,3-8H2,2H3;1H;/q-1;;+2/p-1/t9-;;/m1../s1 |
| InChIKey | WXBACQVDJRKFIY-KLQYNRQASA-M |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|