C30H44N4O6S — CID 169172024
7-ethyl-2-[5-[4-[2-(hydroxyamino)oxyethyl]piperidin-1-yl]sulfonyl-2-propoxyphenyl]-9-propyl-3,5,6,7-tetrahydrocyclohepta[d]pyrimidin-4-one (PubChem CID 169172024) has the molecular formula C30H44N4O6S and a molecular weight of 588.77 g/mol. Its IUPAC name is 7-ethyl-2-[5-[4-[2-(hydroxyamino)oxyethyl]piperidin-1-yl]sulfonyl-2-propoxyphenyl]-9-propyl-3,5,6,7-tetrahydrocyclohepta[d]pyrimidin-4-one.
| Compound Name | 7-ethyl-2-[5-[4-[2-(hydroxyamino)oxyethyl]piperidin-1-yl]sulfonyl-2-propoxyphenyl]-9-propyl-3,5,6,7-tetrahydrocyclohepta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 169172024 |
| Molecular Formula | C30H44N4O6S |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 7-ethyl-2-[5-[4-[2-(hydroxyamino)oxyethyl]piperidin-1-yl]sulfonyl-2-propoxyphenyl]-9-propyl-3,5,6,7-tetrahydrocyclohepta[d]pyrimidin-4-one |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCC(CCONO)CC2)cc1-c1nc2c(c(=O)[nH]1)CCC(CC)C=C2CCC |
| InChI | InChI=1S/C30H44N4O6S/c1-4-7-23-19-21(6-3)8-10-25-28(23)31-29(32-30(25)35)26-20-24(9-11-27(26)39-17-5-2)41(37,38)34-15-12-22(13-16-34)14-18-40-33-36/h9,11,19-22,33,36H,4-8,10,12-18H2,1-3H3,(H,31,32,35) |
| InChIKey | KABXFXHTLQZFHK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|