C19H30F3N7O — CID 169172572
N-[1-[(Z)-3-amino-2-[amino(1,1,1-trifluoropropan-2-yl)amino]prop-2-enyl]pyrazol-4-yl]-3,3-dicyclopropyl-2-(methylamino)propanamide (PubChem CID 169172572) has the molecular formula C19H30F3N7O and a molecular weight of 429.49 g/mol. Its IUPAC name is N-[1-[(Z)-3-amino-2-[amino(1,1,1-trifluoropropan-2-yl)amino]prop-2-enyl]pyrazol-4-yl]-3,3-dicyclopropyl-2-(methylamino)propanamide.
| Compound Name | N-[1-[(Z)-3-amino-2-[amino(1,1,1-trifluoropropan-2-yl)amino]prop-2-enyl]pyrazol-4-yl]-3,3-dicyclopropyl-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 169172572 |
| Molecular Formula | C19H30F3N7O |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | N-[1-[(Z)-3-amino-2-[amino(1,1,1-trifluoropropan-2-yl)amino]prop-2-enyl]pyrazol-4-yl]-3,3-dicyclopropyl-2-(methylamino)propanamide |
| SMILES | CNC(C(=O)Nc1cnn(C/C(=C/N)N(N)C(C)C(F)(F)F)c1)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C19H30F3N7O/c1-11(19(20,21)22)29(24)15(7-23)10-28-9-14(8-26-28)27-18(30)17(25-2)16(12-3-4-12)13-5-6-13/h7-9,11-13,16-17,25H,3-6,10,23-24H2,1-2H3,(H,27,30)/b15-7- |
| InChIKey | QBACLIKSJCXTKQ-CHHVJCJISA-N |
| XLogP | 1.77 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|