C16H12F3N3O2 — CID 169173133
3-methyl-5-nitro-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine (PubChem CID 169173133) has the molecular formula C16H12F3N3O2 and a molecular weight of 335.29 g/mol. Its IUPAC name is 3-methyl-5-nitro-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 3-methyl-5-nitro-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 169173133 |
| Molecular Formula | C16H12F3N3O2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3-methyl-5-nitro-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine |
| SMILES | Cc1cn(Cc2ccc(C(F)(F)F)cc2)c2ncc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C16H12F3N3O2/c1-10-8-21(15-14(10)6-13(7-20-15)22(23)24)9-11-2-4-12(5-3-11)16(17,18)19/h2-8H,9H2,1H3 |
| InChIKey | XYSPGIJPVKRQKK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|