C21H19F5N2OS — CID 169173463
7-(difluoromethylsulfanylamino)-6-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-5-azaspiro[2.4]heptane-5-carbaldehyde (PubChem CID 169173463) has the molecular formula C21H19F5N2OS and a molecular weight of 442.45 g/mol. Its IUPAC name is 7-(difluoromethylsulfanylamino)-6-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-5-azaspiro[2.4]heptane-5-carbaldehyde.
| Compound Name | 7-(difluoromethylsulfanylamino)-6-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-5-azaspiro[2.4]heptane-5-carbaldehyde |
|---|---|
| PubChem CID | 169173463 |
| Molecular Formula | C21H19F5N2OS |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 7-(difluoromethylsulfanylamino)-6-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-5-azaspiro[2.4]heptane-5-carbaldehyde |
| SMILES | O=CN1CC2(CC2)C(NSC(F)F)C1Cc1cccc(-c2cc(F)cc(F)c2)c1F |
| InChI | InChI=1S/C21H19F5N2OS/c22-14-6-13(7-15(23)9-14)16-3-1-2-12(18(16)24)8-17-19(27-30-20(25)26)21(4-5-21)10-28(17)11-29/h1-3,6-7,9,11,17,19-20,27H,4-5,8,10H2 |
| InChIKey | APPNMTPNQJJEQV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|