C21H24F4N2S — CID 154665351
2-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-ethylsulfanyl-4-fluoro-1,4-dimethylpyrrolidin-3-amine (PubChem CID 154665351) has the molecular formula C21H24F4N2S and a molecular weight of 412.50 g/mol. Its IUPAC name is 2-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-ethylsulfanyl-4-fluoro-1,4-dimethylpyrrolidin-3-amine.
| Compound Name | 2-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-ethylsulfanyl-4-fluoro-1,4-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 154665351 |
| Molecular Formula | C21H24F4N2S |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-ethylsulfanyl-4-fluoro-1,4-dimethylpyrrolidin-3-amine |
| SMILES | CCSNC1C(Cc2cccc(-c3cc(F)cc(F)c3)c2F)N(C)CC1(C)F |
| InChI | InChI=1S/C21H24F4N2S/c1-4-28-26-20-18(27(3)12-21(20,2)25)10-13-6-5-7-17(19(13)24)14-8-15(22)11-16(23)9-14/h5-9,11,18,20,26H,4,10,12H2,1-3H3 |
| InChIKey | YUHDZTCOWGEGOB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|