C26H27F3N2O3S — CID 170553396
N-[(1S,3S,4S,6S)-2-(bicyclo[1.1.1]pentane-1-carbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-azabicyclo[4.1.0]heptan-4-yl]methanesulfonamide (PubChem CID 170553396) has the molecular formula C26H27F3N2O3S and a molecular weight of 504.57 g/mol. Its IUPAC name is N-[(1S,3S,4S,6S)-2-(bicyclo[1.1.1]pentane-1-carbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-azabicyclo[4.1.0]heptan-4-yl]methanesulfonamide.
| Compound Name | N-[(1S,3S,4S,6S)-2-(bicyclo[1.1.1]pentane-1-carbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-azabicyclo[4.1.0]heptan-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 170553396 |
| Molecular Formula | C26H27F3N2O3S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | N-[(1S,3S,4S,6S)-2-(bicyclo[1.1.1]pentane-1-carbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-azabicyclo[4.1.0]heptan-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1C[C@@H]2C[C@@H]2N(C(=O)C23CC(C2)C3)[C@H]1Cc1cccc(-c2cc(F)cc(F)c2)c1F |
| InChI | InChI=1S/C26H27F3N2O3S/c1-35(33,34)30-21-7-17-9-22(17)31(25(32)26-11-14(12-26)13-26)23(21)8-15-3-2-4-20(24(15)29)16-5-18(27)10-19(28)6-16/h2-6,10,14,17,21-23,30H,7-9,11-13H2,1H3/t14?,17-,21+,22+,23+,26?/m1/s1 |
| InChIKey | WZNKBPHULJBGBD-UOIYWXCTSA-N |
| XLogP | 4.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |